CAS 70601-63-7 appears in our catalog under these names: O-Methyl-d-tyrosine hydrochloride, 95%, (R)-2-Amino-3-(4-methoxyphenyl)propanoic acid hydrochloride, 97%, 97%, (R)-2-Amino-3-(4-methoxyphenyl)propanoic acid hydrochloride, 97%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 25g, 1g, 5g, 250mg, 10g, 15g.
(2R)-2-amino-3-(4-methoxyphenyl)propanoic acid;hydrochloride (CAS 70601-63-7) is a chemical compound with the molecular formula C10H14ClNO3 and a molecular weight of 231.67 g/mol. IUPAC name: (2R)-2-amino-3-(4-methoxyphenyl)propanoic acid;hydrochloride. InChIKey: OWJANEXICRZDJT-SBSPUUFOSA-N.
| Molecular formula | C10H14ClNO3 |
|---|---|
| Molecular weight | 231.67 g/mol |
| IUPAC name | (2R)-2-amino-3-(4-methoxyphenyl)propanoic acid;hydrochloride |
| InChIKey | OWJANEXICRZDJT-SBSPUUFOSA-N |
| SMILES | COC1=CC=C(C=C1)C[C@H](C(=O)O)N.Cl |
Computed by PubChem (NCBI)