Products 67423-44-3
CAS 67423-44-3 appears in our catalog under these names: (2S)–2–amino–3–(4–methoxyphenyl)propanoic acid，hydrochloride, (S)-2-amino-3-(4-methoxyphenyl)propanoic acid hydrochloride. Offered by: GLPBio, Chemat. Available pack sizes: 25g, 5g.
(2S)-2-amino-3-(4-methoxyphenyl)propanoic acid;hydrochloride (CAS 67423-44-3) is a chemical compound with the molecular formula C10H14ClNO3 and a molecular weight of 231.67 g/mol. IUPAC name: (2S)-2-amino-3-(4-methoxyphenyl)propanoic acid;hydrochloride. InChIKey: OWJANEXICRZDJT-FVGYRXGTSA-N.
| Molecular formula | C10H14ClNO3 |
|---|---|
| Molecular weight | 231.67 g/mol |
| IUPAC name | (2S)-2-amino-3-(4-methoxyphenyl)propanoic acid;hydrochloride |
| InChIKey | OWJANEXICRZDJT-FVGYRXGTSA-N |
| SMILES | COC1=CC=C(C=C1)C[C@@H](C(=O)O)N.Cl |
Computed by PubChem (NCBI)