CAS 16574-07-5 is the registry number for 4-Ethyl-6,7-dihydroxy-2H-chromen-2-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-ethyl-6,7-dihydroxychromen-2-one (CAS 16574-07-5) is a chemical compound with the molecular formula C11H10O4 and a molecular weight of 206.19 g/mol. IUPAC name: 4-ethyl-6,7-dihydroxychromen-2-one. InChIKey: ISESONVYWLLDIF-UHFFFAOYSA-N.
| Molecular formula | C11H10O4 |
|---|---|
| Molecular weight | 206.19 g/mol |
| IUPAC name | 4-ethyl-6,7-dihydroxychromen-2-one |
| InChIKey | ISESONVYWLLDIF-UHFFFAOYSA-N |
| SMILES | CCC1=CC(=O)OC2=CC(=C(C=C12)O)O |
Computed by PubChem (NCBI)