CAS 165947-56-8 is the registry number for Ethyl 5-boc-4,5,6,7-tetrahydrothieno[3,2-c]pyridine-2-methanol, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
Tert-butyl 2-(hydroxymethyl)-6,7-dihydro-4H-thieno[3,2-c]pyridine-5-carboxylate (CAS 165947-56-8) is a chemical compound with the molecular formula C13H19NO3S and a molecular weight of 269.36 g/mol. IUPAC name: tert-butyl 2-(hydroxymethyl)-6,7-dihydro-4H-thieno[3,2-c]pyridine-5-carboxylate. InChIKey: ZDBZERHPDYWTBK-UHFFFAOYSA-N.
| Molecular formula | C13H19NO3S |
|---|---|
| Molecular weight | 269.36 g/mol |
| IUPAC name | tert-butyl 2-(hydroxymethyl)-6,7-dihydro-4H-thieno[3,2-c]pyridine-5-carboxylate |
| InChIKey | ZDBZERHPDYWTBK-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2=C(C1)C=C(S2)CO |
Computed by PubChem (NCBI)