CAS 69291-83-4 is the registry number for Trans-n-(2-hydroxycyclohexyl)-4-methylbenzenesulfonamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
N-[(1R,2R)-2-hydroxycyclohexyl]-4-methylbenzenesulfonamide (CAS 69291-83-4) is a chemical compound with the molecular formula C13H19NO3S and a molecular weight of 269.36 g/mol. IUPAC name: N-[(1R,2R)-2-hydroxycyclohexyl]-4-methylbenzenesulfonamide. InChIKey: QJKXPEKEAIVEGV-CHWSQXEVSA-N.
| Molecular formula | C13H19NO3S |
|---|---|
| Molecular weight | 269.36 g/mol |
| IUPAC name | N-[(1R,2R)-2-hydroxycyclohexyl]-4-methylbenzenesulfonamide |
| InChIKey | QJKXPEKEAIVEGV-CHWSQXEVSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N[C@@H]2CCCC[C@H]2O |
Computed by PubChem (NCBI)