Products 342046-29-1

CAS 342046-29-1 is the registry number for 3-([(Methylthio)carbonyl]amino)adamantane-1-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.

Structural formula: {0} (CAS {1})

3-(methylsulfanylcarbonylamino)adamantane-1-carboxylic acid (CAS 342046-29-1) is a chemical compound with the molecular formula C13H19NO3S and a molecular weight of 269.36 g/mol. IUPAC name: 3-(methylsulfanylcarbonylamino)adamantane-1-carboxylic acid. InChIKey: CFJDXKRKCMCKOD-UHFFFAOYSA-N.

Identity
Molecular formulaC13H19NO3S
Molecular weight269.36 g/mol
IUPAC name3-(methylsulfanylcarbonylamino)adamantane-1-carboxylic acid
InChIKeyCFJDXKRKCMCKOD-UHFFFAOYSA-N
SMILESCSC(=O)NC12CC3CC(C1)CC(C3)(C2)C(=O)O

Computed by PubChem (NCBI)