CAS 2197057-01-3 is the registry number for 4-Amino-4-[(3-methoxyphenyl)methyl]-1lambda(6)-thiane-1,1-dione, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 100mg.
4-[(3-methoxyphenyl)methyl]-1,1-dioxothian-4-amine (CAS 2197057-01-3) is a chemical compound with the molecular formula C13H19NO3S and a molecular weight of 269.36 g/mol. IUPAC name: 4-[(3-methoxyphenyl)methyl]-1,1-dioxothian-4-amine. InChIKey: JUDFEPJDVSQLQK-UHFFFAOYSA-N.
| Molecular formula | C13H19NO3S |
|---|---|
| Molecular weight | 269.36 g/mol |
| IUPAC name | 4-[(3-methoxyphenyl)methyl]-1,1-dioxothian-4-amine |
| InChIKey | JUDFEPJDVSQLQK-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC(=C1)CC2(CCS(=O)(=O)CC2)N |
Computed by PubChem (NCBI)