Products 165949-85-9
CAS 165949-85-9 appears in our catalog under these names: 3-(1-Aminoethyl)benzoic acid hydrochloride, 95%, 3–(1–Aminoethyl)benzoic acid hydrochloride, 3-(1-Aminoethyl)benzoic acid hydrochloride, 98%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 100mg, 1g, 5g.
3-(1-aminoethyl)benzoic acid;hydrochloride (CAS 165949-85-9) is a chemical compound with the molecular formula C9H12ClNO2 and a molecular weight of 201.65 g/mol. IUPAC name: 3-(1-aminoethyl)benzoic acid;hydrochloride. InChIKey: JNHHIGNEAULTBO-UHFFFAOYSA-N.
| Molecular formula | C9H12ClNO2 |
|---|---|
| Molecular weight | 201.65 g/mol |
| IUPAC name | 3-(1-aminoethyl)benzoic acid;hydrochloride |
| InChIKey | JNHHIGNEAULTBO-UHFFFAOYSA-N |
| SMILES | CC(C1=CC(=CC=C1)C(=O)O)N.Cl |
Computed by PubChem (NCBI)