CAS 16633-45-7 appears in our catalog under these names: trans–2–(3–chlorophenyl)cyclopropane–1–carboxylic acid, rac-(1R,2R)-2-(3-Chlorophenyl)cyclopropane-1-carboxylic acid, Rel-(1R,2R)-2-(3-chlorophenyl)cyclopropane-1-carboxylic acid. Offered by: GLPBio, Biosynth, Chemat. Available pack sizes: 1g, 500mg, 5g, 50mg, 0,5g.
Trans-(1R,2R)-2-(3-chlorophenyl)cyclopropane-1-carboxylic acid (CAS 16633-45-7) is a chemical compound with the molecular formula C10H9ClO2 and a molecular weight of 196.63 g/mol. IUPAC name: trans-(1R,2R)-2-(3-chlorophenyl)cyclopropane-1-carboxylic acid. InChIKey: YGWYJGWUNQIPPV-DTWKUNHWSA-N.
| Molecular formula | C10H9ClO2 |
|---|---|
| Molecular weight | 196.63 g/mol |
| IUPAC name | trans-(1R,2R)-2-(3-chlorophenyl)cyclopropane-1-carboxylic acid |
| InChIKey | YGWYJGWUNQIPPV-DTWKUNHWSA-N |
| SMILES | C1[C@H]([C@@H]1C(=O)O)C2=CC(=CC=C2)Cl |
Computed by PubChem (NCBI)