Products 515179-15-4
CAS 515179-15-4 is the registry number for (1S,2S)-2-(3-Chlorophenyl)cyclopropanecarboxylicAcid, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g.
Trans-(1S,2S)-2-(3-chlorophenyl)cyclopropane-1-carboxylic acid (CAS 515179-15-4) is a chemical compound with the molecular formula C10H9ClO2 and a molecular weight of 196.63 g/mol. IUPAC name: trans-(1S,2S)-2-(3-chlorophenyl)cyclopropane-1-carboxylic acid. InChIKey: YGWYJGWUNQIPPV-BDAKNGLRSA-N.
| Molecular formula | C10H9ClO2 |
|---|---|
| Molecular weight | 196.63 g/mol |
| IUPAC name | trans-(1S,2S)-2-(3-chlorophenyl)cyclopropane-1-carboxylic acid |
| InChIKey | YGWYJGWUNQIPPV-BDAKNGLRSA-N |
| SMILES | C1[C@@H]([C@H]1C(=O)O)C2=CC(=CC=C2)Cl |
Computed by PubChem (NCBI)