Products 1664-57-9
CAS 1664-57-9 appears in our catalog under these names: 3–(3–Nitrophenyl)propionic Acid, 3-(3-Nitrophenyl)propionic Acid, >98.0%(GC)(T), 3-(3-Nitrophenyl)propionic acid 98%, 3-(3-Nitrophenyl)propionic acid, 98%, 98%, 3-(3-Nitrophenyl)propionic acid, 98%. Offered by: GLPBio, TCI, Ambeed, Chemat, Fluorochem. Available pack sizes: 100g, 25g, 500g, 5g, 1000g, 10g, 1g.
3-(3-nitrophenyl)propanoic acid (CAS 1664-57-9) is a chemical compound with the molecular formula C9H9NO4 and a molecular weight of 195.17 g/mol. IUPAC name: 3-(3-nitrophenyl)propanoic acid. InChIKey: ZOANOABZUNJOJT-UHFFFAOYSA-N.
| Molecular formula | C9H9NO4 |
|---|---|
| Molecular weight | 195.17 g/mol |
| IUPAC name | 3-(3-nitrophenyl)propanoic acid |
| InChIKey | ZOANOABZUNJOJT-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)[N+](=O)[O-])CCC(=O)O |
Computed by PubChem (NCBI)