CAS 1671064-19-9 is the registry number for Methyl 5-(benzyloxy)-2-methyl-1H-indole-3-carboxylate, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g.
Methyl 2-methyl-5-phenylmethoxy-1H-indole-3-carboxylate (CAS 1671064-19-9) is a chemical compound with the molecular formula C18H17NO3 and a molecular weight of 295.3 g/mol. IUPAC name: methyl 2-methyl-5-phenylmethoxy-1H-indole-3-carboxylate. InChIKey: ISYIFHKUOVGYJP-UHFFFAOYSA-N.
| Molecular formula | C18H17NO3 |
|---|---|
| Molecular weight | 295.3 g/mol |
| IUPAC name | methyl 2-methyl-5-phenylmethoxy-1H-indole-3-carboxylate |
| InChIKey | ISYIFHKUOVGYJP-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=C(N1)C=CC(=C2)OCC3=CC=CC=C3)C(=O)OC |
Computed by PubChem (NCBI)