Products 167283-32-1

CAS 167283-32-1 is the registry number for N-(p-Tolyl)indole, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g.

Structural formula: {0} (CAS {1})

1-(4-methylphenyl)indole (CAS 167283-32-1) is a chemical compound with the molecular formula C15H13N and a molecular weight of 207.27 g/mol. IUPAC name: 1-(4-methylphenyl)indole. InChIKey: ROVUACXZYQYJQS-UHFFFAOYSA-N.

Identity
Molecular formulaC15H13N
Molecular weight207.27 g/mol
IUPAC name1-(4-methylphenyl)indole
InChIKeyROVUACXZYQYJQS-UHFFFAOYSA-N
SMILESCC1=CC=C(C=C1)N2C=CC3=CC=CC=C32

Computed by PubChem (NCBI)