CAS 167283-33-2 is the registry number for 1-(4-Chlorophenyl)-1H-indole, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 10g, 25g, 50g.
1-(4-chlorophenyl)indole (CAS 167283-33-2) is a chemical compound with the molecular formula C14H10ClN and a molecular weight of 227.69 g/mol. IUPAC name: 1-(4-chlorophenyl)indole. InChIKey: KHYIDGIPLSNPHO-UHFFFAOYSA-N.
| Molecular formula | C14H10ClN |
|---|---|
| Molecular weight | 227.69 g/mol |
| IUPAC name | 1-(4-chlorophenyl)indole |
| InChIKey | KHYIDGIPLSNPHO-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CN2C3=CC=C(C=C3)Cl |
Computed by PubChem (NCBI)