Products 1676-74-0
CAS 1676-74-0 is the registry number for (4S)-4-(1H-Indol-3-ylmethyl)-2,5-oxazolidinedione, 98%. Offered by: Fluorochem. Available pack sizes: 1g, 5g.
(4S)-4-(1H-indol-3-ylmethyl)-1,3-oxazolidine-2,5-dione (CAS 1676-74-0) is a chemical compound with the molecular formula C12H10N2O3 and a molecular weight of 230.22 g/mol. IUPAC name: (4S)-4-(1H-indol-3-ylmethyl)-1,3-oxazolidine-2,5-dione. InChIKey: PZEKHTMDKRBNKY-JTQLQIEISA-N.
| Molecular formula | C12H10N2O3 |
|---|---|
| Molecular weight | 230.22 g/mol |
| IUPAC name | (4S)-4-(1H-indol-3-ylmethyl)-1,3-oxazolidine-2,5-dione |
| InChIKey | PZEKHTMDKRBNKY-JTQLQIEISA-N |
| SMILES | C1=CC=C2C(=C1)C(=CN2)C[C@H]3C(=O)OC(=O)N3 |
Computed by PubChem (NCBI)