CAS 167626-50-8 is the registry number for Methyl 3-amino-4-(1H-1,2,4-triazol-1-yl)benzoate, 95+%. Offered by: AmBeed. Available pack sizes: 1g.
Methyl 3-amino-4-(1,2,4-triazol-1-yl)benzoate (CAS 167626-50-8) is a chemical compound with the molecular formula C10H10N4O2 and a molecular weight of 218.21 g/mol. IUPAC name: methyl 3-amino-4-(1,2,4-triazol-1-yl)benzoate. InChIKey: HUAQXKUFBUHCCA-UHFFFAOYSA-N.
| Molecular formula | C10H10N4O2 |
|---|---|
| Molecular weight | 218.21 g/mol |
| IUPAC name | methyl 3-amino-4-(1,2,4-triazol-1-yl)benzoate |
| InChIKey | HUAQXKUFBUHCCA-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C=C1)N2C=NC=N2)N |
Computed by PubChem (NCBI)