Products 167630-15-1
CAS 167630-15-1 is the registry number for 3-Hydroxy-5-(methoxycarbonyl)benzoic acid. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
3-hydroxy-5-methoxycarbonylbenzoic acid (CAS 167630-15-1) is a chemical compound with the molecular formula C9H8O5 and a molecular weight of 196.16 g/mol. IUPAC name: 3-hydroxy-5-methoxycarbonylbenzoic acid. InChIKey: GWUUUIMPMKEIAZ-UHFFFAOYSA-N.
| Molecular formula | C9H8O5 |
|---|---|
| Molecular weight | 196.16 g/mol |
| IUPAC name | 3-hydroxy-5-methoxycarbonylbenzoic acid |
| InChIKey | GWUUUIMPMKEIAZ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=CC(=C1)C(=O)O)O |
Computed by PubChem (NCBI)
Synonyms:
3-Hydroxy-5-(methoxycarbonyl)benzoic acid, 3-hydroxy-5-methoxycarbonylbenzoic acid, 5-hydroxy-isopththalic acid monomethyl ester, 1,3-Benzenedicarboxylic acid, 5-hydroxy-, 1-methyl ester, 3-Hydroxy-5-(methoxycarbonyl)benzoicacid, GWUUUIMPMKEIAZ-UHFFFAOYSA-N, 5-Hydroxy-isophthalic acid methylester, 3-hydroxy-5-methoxycarbonyl-benzoic acid