CAS 167773-06-0 appears in our catalog under these names: 2-Buten-2-ylboronic acid pinacol ester, 2-(But-2-en-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane 95%. Offered by: Biosynth, Ambeed. Available pack sizes: 1g, 100mg, 250mg.
2-but-2-en-2-yl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 167773-06-0) is a chemical compound with the molecular formula C10H19BO2 and a molecular weight of 182.07 g/mol. IUPAC name: 2-but-2-en-2-yl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: HEZPWTQUZJEVQF-UHFFFAOYSA-N.
| Molecular formula | C10H19BO2 |
|---|---|
| Molecular weight | 182.07 g/mol |
| IUPAC name | 2-but-2-en-2-yl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | HEZPWTQUZJEVQF-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C(=CC)C |
Computed by PubChem (NCBI)