CAS 91890-00-5 appears in our catalog under these names: (Z)-2-Buten-2-ylboronic acid pinacol ester 97%, (Z)-2-Buten-2-ylboronic acid pinacol ester, 97%, 97%, (Z)-2-(But-2-en-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 97%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 50g, 250g, 500g.
2-[(Z)-but-2-en-2-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 91890-00-5) is a chemical compound with the molecular formula C10H19BO2 and a molecular weight of 182.07 g/mol. IUPAC name: 2-[(Z)-but-2-en-2-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: HEZPWTQUZJEVQF-BQYQJAHWSA-N.
| Molecular formula | C10H19BO2 |
|---|---|
| Molecular weight | 182.07 g/mol |
| IUPAC name | 2-[(Z)-but-2-en-2-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | HEZPWTQUZJEVQF-BQYQJAHWSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)/C(=C/C)/C |
Computed by PubChem (NCBI)