CAS 16855-41-7 appears in our catalog under these names: 1-(Bromomethyl)-4-nitronaphthalene, 95%, 1-(Bromomethyl)-4-nitronaphthalene, 96%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
1-(bromomethyl)-4-nitronaphthalene (CAS 16855-41-7) is a chemical compound with the molecular formula C11H8BrNO2 and a molecular weight of 266.09 g/mol. IUPAC name: 1-(bromomethyl)-4-nitronaphthalene. InChIKey: SJOQNSWOKVTGMG-UHFFFAOYSA-N.
| Molecular formula | C11H8BrNO2 |
|---|---|
| Molecular weight | 266.09 g/mol |
| IUPAC name | 1-(bromomethyl)-4-nitronaphthalene |
| InChIKey | SJOQNSWOKVTGMG-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CC=C2[N+](=O)[O-])CBr |
Computed by PubChem (NCBI)