CAS 168837-90-9 is the registry number for 2-Methylfuro[2',3':4,5]pyrrolo[1,2-d][1,2,4]triazin-8(7H)-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-methyl-5-oxa-1,10,11-triazatricyclo[6.4.0.02,6]dodeca-2(6),3,7,11-tetraen-9-one (CAS 168837-90-9) is a chemical compound with the molecular formula C9H7N3O2 and a molecular weight of 189.17 g/mol. IUPAC name: 4-methyl-5-oxa-1,10,11-triazatricyclo[6.4.0.02,6]dodeca-2(6),3,7,11-tetraen-9-one. InChIKey: OCTLXJHCBUXCEQ-UHFFFAOYSA-N.
| Molecular formula | C9H7N3O2 |
|---|---|
| Molecular weight | 189.17 g/mol |
| IUPAC name | 4-methyl-5-oxa-1,10,11-triazatricyclo[6.4.0.02,6]dodeca-2(6),3,7,11-tetraen-9-one |
| InChIKey | OCTLXJHCBUXCEQ-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(O1)C=C3N2C=NNC3=O |
Computed by PubChem (NCBI)