CAS 1689575-80-1 is the registry number for 2-(6-Fluoro-1-methyl-1H-indol-3-yl)ethan-1-amine hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-(6-fluoro-1-methylindol-3-yl)ethanamine;hydrochloride (CAS 1689575-80-1) is a chemical compound with the molecular formula C11H14ClFN2 and a molecular weight of 228.69 g/mol. IUPAC name: 2-(6-fluoro-1-methylindol-3-yl)ethanamine;hydrochloride. InChIKey: QOVCFWBMWSXFTG-UHFFFAOYSA-N.
| Molecular formula | C11H14ClFN2 |
|---|---|
| Molecular weight | 228.69 g/mol |
| IUPAC name | 2-(6-fluoro-1-methylindol-3-yl)ethanamine;hydrochloride |
| InChIKey | QOVCFWBMWSXFTG-UHFFFAOYSA-N |
| SMILES | CN1C=C(C2=C1C=C(C=C2)F)CCN.Cl |
Computed by PubChem (NCBI)