CAS 1690692-63-7 appears in our catalog under these names: 2,8–Dichloro–7–methylquinoline, 2,8-Dichloro-7-methylquinoline 98%, 2,8-Dichloro-7-methylquinoline, 98%, 2,8-Dichloro-7-methylquinoline, 98%, 98%. Offered by: GLPBio, Ambeed, Fluorochem, Chemat. Available pack sizes: 100mg, 1g, 250mg, 5g.
2,8-dichloro-7-methylquinoline (CAS 1690692-63-7) is a chemical compound with the molecular formula C10H7Cl2N and a molecular weight of 212.07 g/mol. IUPAC name: 2,8-dichloro-7-methylquinoline. InChIKey: QRGVQWJGKRBIQW-UHFFFAOYSA-N.
| Molecular formula | C10H7Cl2N |
|---|---|
| Molecular weight | 212.07 g/mol |
| IUPAC name | 2,8-dichloro-7-methylquinoline |
| InChIKey | QRGVQWJGKRBIQW-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=C(C=C1)C=CC(=N2)Cl)Cl |
Computed by PubChem (NCBI)