CAS 1482-74-2 appears in our catalog under these names: 2',3',4'-Trihydroxychalcone, 2',3',4'-Trihydroxychalcone, 97%, 2',3',4'-TRIHYDROXYCHALCONE, 95%, 2',3',4'-TRIHYDROXYCHALCONE, 98%,RG, 98%,RG. Offered by: Biosynth, Combi-blocks, Fluorochem, Chemat. Available pack sizes: 0,25g, 0,1g, 0,5g, 1g, 10g, 25g, 5g, 100mg.
(E)-3-phenyl-1-(2,3,4-trihydroxyphenyl)prop-2-en-1-one (CAS 1482-74-2) is a chemical compound with the molecular formula C15H12O4 and a molecular weight of 256.25 g/mol. IUPAC name: (E)-3-phenyl-1-(2,3,4-trihydroxyphenyl)prop-2-en-1-one. InChIKey: MSDGTBGJKOTHCN-SOFGYWHQSA-N.
| Molecular formula | C15H12O4 |
|---|---|
| Molecular weight | 256.25 g/mol |
| IUPAC name | (E)-3-phenyl-1-(2,3,4-trihydroxyphenyl)prop-2-en-1-one |
| InChIKey | MSDGTBGJKOTHCN-SOFGYWHQSA-N |
| SMILES | C1=CC=C(C=C1)/C=C/C(=O)C2=C(C(=C(C=C2)O)O)O |
Computed by PubChem (NCBI)