CAS 92496-89-4 appears in our catalog under these names: 4',3,4-Trihydroxychalcone, 4',3,4-Trihydroxychalcone, 95%. Offered by: Biosynth, Combi-blocks. Available pack sizes: 25mg, 10mg, 50mg, 100mg, 250mg.
(E)-3-(3,4-dihydroxyphenyl)-1-(4-hydroxyphenyl)prop-2-en-1-one (CAS 92496-89-4) is a chemical compound with the molecular formula C15H12O4 and a molecular weight of 256.25 g/mol. IUPAC name: (E)-3-(3,4-dihydroxyphenyl)-1-(4-hydroxyphenyl)prop-2-en-1-one. InChIKey: UPERCWWUZZKHCL-LREOWRDNSA-N.
| Molecular formula | C15H12O4 |
|---|---|
| Molecular weight | 256.25 g/mol |
| IUPAC name | (E)-3-(3,4-dihydroxyphenyl)-1-(4-hydroxyphenyl)prop-2-en-1-one |
| InChIKey | UPERCWWUZZKHCL-LREOWRDNSA-N |
| SMILES | C1=CC(=CC=C1C(=O)/C=C/C2=CC(=C(C=C2)O)O)O |
Computed by PubChem (NCBI)