Products 1697762-69-8
CAS 1697762-69-8 is the registry number for Methyl 2-chloro-2-(3,5-difluorophenyl)acetate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
Methyl 2-chloro-2-(3,5-difluorophenyl)acetate (CAS 1697762-69-8) is a chemical compound with the molecular formula C9H7ClF2O2 and a molecular weight of 220.60 g/mol. IUPAC name: methyl 2-chloro-2-(3,5-difluorophenyl)acetate. InChIKey: YDSMCJVRECMVIP-UHFFFAOYSA-N.
| Molecular formula | C9H7ClF2O2 |
|---|---|
| Molecular weight | 220.60 g/mol |
| IUPAC name | methyl 2-chloro-2-(3,5-difluorophenyl)acetate |
| InChIKey | YDSMCJVRECMVIP-UHFFFAOYSA-N |
| SMILES | COC(=O)C(C1=CC(=CC(=C1)F)F)Cl |
Computed by PubChem (NCBI)