Boc-DL-Tle-OH, 98%, 98%
cas: 169870-82-0 — see every product listed under this CAS number, including other names
Boc-DL-Tle-OH, 98%, 98% (CAS 169870-82-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 25g, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1117TV-100mg |
| cas | 169870-82-0 |
| size | 100mg |
| availability | 75g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 141.20 Pln | |
| Chemat | 250mg | 198.80 Pln | |
| Chemat | 25g | 2200.40 Pln | |
| Chemat | 1g | 390.80 Pln | |
| Chemat | 5g | 894.80 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
3,3-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid (CAS 169870-82-0) is a chemical compound with the molecular formula C11H21NO4 and a molecular weight of 231.29 g/mol. IUPAC name: 3,3-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid. InChIKey: LRFZIPCTFBPFLX-UHFFFAOYSA-N.
| Molecular formula | C11H21NO4 |
|---|---|
| Molecular weight | 231.29 g/mol |
| IUPAC name | 3,3-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid |
| InChIKey | LRFZIPCTFBPFLX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(C(=O)O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)
Synonyms:
2-{[(tert-butoxy)carbonyl]amino}-3,3-dimethylbutanoic acid, 2-(((tert-butoxy)carbonyl)amino)-3,3-dimethylbutanoic acid, Boc-Dl-Tle-Oh, 2-((tert-Butoxycarbonyl)amino)-3,3-dimethylbutanoic acid, N-Boc-t-butylglycine, 2-tert-butoxycarbonylamino-3,3-dimethyl-butyric acid, 3,3-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic Acid, N-Boc-DL-tert-leucine, 2-(tert-butoxycarbonylamino)-3,3-dimethylbutanoic acid, boc-tbu-dl-gly-oh