CAS 169885-19-2 appears in our catalog under these names: (R)–methyl 3–((1,1'–biphenyl)–4–yl)–2–aminopropanoate hydrochloride, (R)-Methyl 3-([1,1'-biphenyl]-4-yl)-2-aminopropanoate hydrochloride, 98%, 98%, (R)-Methyl 3-([1,1'-biphenyl]-4-yl)-2-aminopropanoate, 98%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg.
Methyl (2R)-2-amino-3-(4-phenylphenyl)propanoate (CAS 169885-19-2) is a chemical compound with the molecular formula C16H17NO2 and a molecular weight of 255.31 g/mol. IUPAC name: methyl (2R)-2-amino-3-(4-phenylphenyl)propanoate. InChIKey: ZABGKWGFGXZMDE-OAHLLOKOSA-N.
| Molecular formula | C16H17NO2 |
|---|---|
| Molecular weight | 255.31 g/mol |
| IUPAC name | methyl (2R)-2-amino-3-(4-phenylphenyl)propanoate |
| InChIKey | ZABGKWGFGXZMDE-OAHLLOKOSA-N |
| SMILES | COC(=O)[C@@H](CC1=CC=C(C=C1)C2=CC=CC=C2)N |
Computed by PubChem (NCBI)