Products 1699333-71-5
CAS 1699333-71-5 is the registry number for 1-(2-chloro-4,5-difluorophenyl)-2,2-difluoroethan-1-one, ≥95%. Offered by: Chemat. Available pack sizes: 250mg, 500mg.
1-(2-chloro-4,5-difluorophenyl)-2,2-difluoroethanone (CAS 1699333-71-5) is a chemical compound with the molecular formula C8H3ClF4O and a molecular weight of 226.55 g/mol. IUPAC name: 1-(2-chloro-4,5-difluorophenyl)-2,2-difluoroethanone. InChIKey: HWCCFOOSHXEQOA-UHFFFAOYSA-N.
| Molecular formula | C8H3ClF4O |
|---|---|
| Molecular weight | 226.55 g/mol |
| IUPAC name | 1-(2-chloro-4,5-difluorophenyl)-2,2-difluoroethanone |
| InChIKey | HWCCFOOSHXEQOA-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1F)F)Cl)C(=O)C(F)F |
Computed by PubChem (NCBI)