CAS 17012-31-6 is the registry number for 3-Chloro-1-methyl-5,6,7,8-tetrahydroisoquinoline-4-carbonitrile. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
3-chloro-1-methyl-5,6,7,8-tetrahydroisoquinoline-4-carbonitrile (CAS 17012-31-6) is a chemical compound with the molecular formula C11H11ClN2 and a molecular weight of 206.67 g/mol. IUPAC name: 3-chloro-1-methyl-5,6,7,8-tetrahydroisoquinoline-4-carbonitrile. InChIKey: FYNCNVGZPPZNPY-UHFFFAOYSA-N.
| Molecular formula | C11H11ClN2 |
|---|---|
| Molecular weight | 206.67 g/mol |
| IUPAC name | 3-chloro-1-methyl-5,6,7,8-tetrahydroisoquinoline-4-carbonitrile |
| InChIKey | FYNCNVGZPPZNPY-UHFFFAOYSA-N |
| SMILES | CC1=C2CCCCC2=C(C(=N1)Cl)C#N |
Computed by PubChem (NCBI)