CAS 17012-47-4 is the registry number for 8-Methoxy-5-nitroquinoline, 95%. Offered by: AmBeed. Available pack sizes: 5g, 10g.
8-methoxy-5-nitroquinoline (CAS 17012-47-4) is a chemical compound with the molecular formula C10H8N2O3 and a molecular weight of 204.18 g/mol. IUPAC name: 8-methoxy-5-nitroquinoline. InChIKey: TUICZSFZAWPHQN-UHFFFAOYSA-N.
| Molecular formula | C10H8N2O3 |
|---|---|
| Molecular weight | 204.18 g/mol |
| IUPAC name | 8-methoxy-5-nitroquinoline |
| InChIKey | TUICZSFZAWPHQN-UHFFFAOYSA-N |
| SMILES | COC1=C2C(=C(C=C1)[N+](=O)[O-])C=CC=N2 |
Computed by PubChem (NCBI)