CAS 170130-12-8 is the registry number for 2,8-Dichloro-4-methoxyquinazoline, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2,8-dichloro-4-methoxyquinazoline (CAS 170130-12-8) is a chemical compound with the molecular formula C9H6Cl2N2O and a molecular weight of 229.06 g/mol. IUPAC name: 2,8-dichloro-4-methoxyquinazoline. InChIKey: CZWULQYFAWVTBI-UHFFFAOYSA-N.
| Molecular formula | C9H6Cl2N2O |
|---|---|
| Molecular weight | 229.06 g/mol |
| IUPAC name | 2,8-dichloro-4-methoxyquinazoline |
| InChIKey | CZWULQYFAWVTBI-UHFFFAOYSA-N |
| SMILES | COC1=NC(=NC2=C1C=CC=C2Cl)Cl |
Computed by PubChem (NCBI)