Products 1702801-86-2
CAS 1702801-86-2 is the registry number for 1,6-Dihydro-6-oxo-N-(2-thienylmethyl)-2-pyridinecarboxamide, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
6-oxo-N-(thiophen-2-ylmethyl)-1H-pyridine-2-carboxamide (CAS 1702801-86-2) is a chemical compound with the molecular formula C11H10N2O2S and a molecular weight of 234.28 g/mol. IUPAC name: 6-oxo-N-(thiophen-2-ylmethyl)-1H-pyridine-2-carboxamide. InChIKey: GGUMGJZYWPKAQE-UHFFFAOYSA-N.
| Molecular formula | C11H10N2O2S |
|---|---|
| Molecular weight | 234.28 g/mol |
| IUPAC name | 6-oxo-N-(thiophen-2-ylmethyl)-1H-pyridine-2-carboxamide |
| InChIKey | GGUMGJZYWPKAQE-UHFFFAOYSA-N |
| SMILES | C1=CC(=O)NC(=C1)C(=O)NCC2=CC=CS2 |
Computed by PubChem (NCBI)