Products 170305-26-7
CAS 170305-26-7 appears in our catalog under these names: 2-Amino-3-(pyrrolidin-1-yl)propanoic acid dihydrochloride, 98%, 98%, 2-Amino-3-(pyrrolidin-1-yl)propanoic acid dihydrochloride, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg.
2-amino-3-pyrrolidin-1-ylpropanoic acid;dihydrochloride (CAS 170305-26-7) is a chemical compound with the molecular formula C7H16Cl2N2O2 and a molecular weight of 231.12 g/mol. IUPAC name: 2-amino-3-pyrrolidin-1-ylpropanoic acid;dihydrochloride. InChIKey: RBMUVKZMASLNGJ-UHFFFAOYSA-N.
| Molecular formula | C7H16Cl2N2O2 |
|---|---|
| Molecular weight | 231.12 g/mol |
| IUPAC name | 2-amino-3-pyrrolidin-1-ylpropanoic acid;dihydrochloride |
| InChIKey | RBMUVKZMASLNGJ-UHFFFAOYSA-N |
| SMILES | C1CCN(C1)CC(C(=O)O)N.Cl.Cl |
Computed by PubChem (NCBI)