CAS 1703958-55-7 is the registry number for Methyl (S)-2-amino-2-(2,4-dichlorophenyl)acetate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl (2S)-2-amino-2-(2,4-dichlorophenyl)acetate (CAS 1703958-55-7) is a chemical compound with the molecular formula C9H9Cl2NO2 and a molecular weight of 234.08 g/mol. IUPAC name: methyl (2S)-2-amino-2-(2,4-dichlorophenyl)acetate. InChIKey: QAOMIBWFHLOTTI-QMMMGPOBSA-N.
| Molecular formula | C9H9Cl2NO2 |
|---|---|
| Molecular weight | 234.08 g/mol |
| IUPAC name | methyl (2S)-2-amino-2-(2,4-dichlorophenyl)acetate |
| InChIKey | QAOMIBWFHLOTTI-QMMMGPOBSA-N |
| SMILES | COC(=O)[C@H](C1=C(C=C(C=C1)Cl)Cl)N |
Computed by PubChem (NCBI)