CAS 1704074-39-4 is the registry number for (3-(1,4-dioxa-8-azaspiro[4.5]decan-8-ylmethyl)-4-chlorophenyl)boronic acid, 98+%. Offered by: Chemat Brand. Available pack sizes: on request.
[4-chloro-3-(1,4-dioxa-8-azaspiro[4.5]decan-8-ylmethyl)phenyl]boronic acid (CAS 1704074-39-4) is a chemical compound with the molecular formula C14H19BClNO4 and a molecular weight of 311.57 g/mol. IUPAC name: [4-chloro-3-(1,4-dioxa-8-azaspiro[4.5]decan-8-ylmethyl)phenyl]boronic acid. InChIKey: ZZIGZEUJULOYDA-UHFFFAOYSA-N.
| Molecular formula | C14H19BClNO4 |
|---|---|
| Molecular weight | 311.57 g/mol |
| IUPAC name | [4-chloro-3-(1,4-dioxa-8-azaspiro[4.5]decan-8-ylmethyl)phenyl]boronic acid |
| InChIKey | ZZIGZEUJULOYDA-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)Cl)CN2CCC3(CC2)OCCO3)(O)O |
Computed by PubChem (NCBI)