CAS 2377611-97-5 is the registry number for Methyl 2-amino-5-chloro-4-(tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
Methyl 2-amino-5-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate (CAS 2377611-97-5) is a chemical compound with the molecular formula C14H19BClNO4 and a molecular weight of 311.57 g/mol. IUPAC name: methyl 2-amino-5-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate. InChIKey: MAWPCWDBKQRYPJ-UHFFFAOYSA-N.
| Molecular formula | C14H19BClNO4 |
|---|---|
| Molecular weight | 311.57 g/mol |
| IUPAC name | methyl 2-amino-5-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate |
| InChIKey | MAWPCWDBKQRYPJ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2Cl)C(=O)OC)N |
Computed by PubChem (NCBI)