Products 741709-70-6
CAS 741709-70-6 appears in our catalog under these names: 2-Chloro-6-(ethoxycarbonyl)pyridine-4-boronic acid, pinacol ester, 96%, 2-Chloro-6-(ethoxycarbonyl)pyridine-4-boronic acid, pinacol ester. Offered by: Combi-blocks, TRC. Available pack sizes: 1g, 250mg.
Ethyl 6-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-2-carboxylate (CAS 741709-70-6) is a chemical compound with the molecular formula C14H19BClNO4 and a molecular weight of 311.57 g/mol. IUPAC name: ethyl 6-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-2-carboxylate. InChIKey: JOOSYBYWNZTCQF-UHFFFAOYSA-N.
| Molecular formula | C14H19BClNO4 |
|---|---|
| Molecular weight | 311.57 g/mol |
| IUPAC name | ethyl 6-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-2-carboxylate |
| InChIKey | JOOSYBYWNZTCQF-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=NC(=C2)Cl)C(=O)OCC |
Computed by PubChem (NCBI)