CAS 2774614-52-5 is the registry number for Methyl 4-amino-2-chloro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 4-amino-2-chloro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate (CAS 2774614-52-5) is a chemical compound with the molecular formula C14H19BClNO4 and a molecular weight of 311.57 g/mol. IUPAC name: methyl 4-amino-2-chloro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate. InChIKey: VGAOBKVPVXEUOB-UHFFFAOYSA-N.
| Molecular formula | C14H19BClNO4 |
|---|---|
| Molecular weight | 311.57 g/mol |
| IUPAC name | methyl 4-amino-2-chloro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate |
| InChIKey | VGAOBKVPVXEUOB-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2N)Cl)C(=O)OC |
Computed by PubChem (NCBI)