CAS 741709-69-3 is the registry number for 2-Chloro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinecarboxylic acid ethyl ester, 98%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
Ethyl 2-chloro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-3-carboxylate (CAS 741709-69-3) is a chemical compound with the molecular formula C14H19BClNO4 and a molecular weight of 311.57 g/mol. IUPAC name: ethyl 2-chloro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-3-carboxylate. InChIKey: DWVMXIMUMXMRJY-UHFFFAOYSA-N.
| Molecular formula | C14H19BClNO4 |
|---|---|
| Molecular weight | 311.57 g/mol |
| IUPAC name | ethyl 2-chloro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-3-carboxylate |
| InChIKey | DWVMXIMUMXMRJY-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(N=C2)Cl)C(=O)OCC |
Computed by PubChem (NCBI)