CAS 1704074-53-2 is the registry number for (4–(1,4–Dioxa–8–azaspiro(4·5)decan–8–ylmethyl)–3–chlorophenyl)boronic acid. Offered by: GLPBio. Available pack sizes: 1g.
[3-chloro-4-(1,4-dioxa-8-azaspiro[4.5]decan-8-ylmethyl)phenyl]boronic acid (CAS 1704074-53-2) is a chemical compound with the molecular formula C14H19BClNO4 and a molecular weight of 311.57 g/mol. IUPAC name: [3-chloro-4-(1,4-dioxa-8-azaspiro[4.5]decan-8-ylmethyl)phenyl]boronic acid. InChIKey: IIZSCOCRIMLYGC-UHFFFAOYSA-N.
| Molecular formula | C14H19BClNO4 |
|---|---|
| Molecular weight | 311.57 g/mol |
| IUPAC name | [3-chloro-4-(1,4-dioxa-8-azaspiro[4.5]decan-8-ylmethyl)phenyl]boronic acid |
| InChIKey | IIZSCOCRIMLYGC-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)CN2CCC3(CC2)OCCO3)Cl)(O)O |
Computed by PubChem (NCBI)