CAS 170456-83-4 appears in our catalog under these names: 1-Tosylpyrrolidin-3-ol 95+%, 1-Tosylpyrrolidin-3-ol, 95%, 95%. Offered by: Ambeed, Chemat. Available pack sizes: 250mg, 1g, 5g.
1-(4-methylphenyl)sulfonylpyrrolidin-3-ol (CAS 170456-83-4) is a chemical compound with the molecular formula C11H15NO3S and a molecular weight of 241.31 g/mol. IUPAC name: 1-(4-methylphenyl)sulfonylpyrrolidin-3-ol. InChIKey: GOIRRXGVYYWCGC-UHFFFAOYSA-N.
| Molecular formula | C11H15NO3S |
|---|---|
| Molecular weight | 241.31 g/mol |
| IUPAC name | 1-(4-methylphenyl)sulfonylpyrrolidin-3-ol |
| InChIKey | GOIRRXGVYYWCGC-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N2CCC(C2)O |
Computed by PubChem (NCBI)