CAS 170497-64-0 appears in our catalog under these names: 6-Phenyl-2,3-dihydro-1H-inden-1-one, 95%, 6-Phenyl-2,3-dihydro-1H-inden-1-one. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
6-phenyl-2,3-dihydroinden-1-one (CAS 170497-64-0) is a chemical compound with the molecular formula C15H12O and a molecular weight of 208.25 g/mol. IUPAC name: 6-phenyl-2,3-dihydroinden-1-one. InChIKey: GLLPDNBBNZQPFH-UHFFFAOYSA-N.
| Molecular formula | C15H12O |
|---|---|
| Molecular weight | 208.25 g/mol |
| IUPAC name | 6-phenyl-2,3-dihydroinden-1-one |
| InChIKey | GLLPDNBBNZQPFH-UHFFFAOYSA-N |
| SMILES | C1CC(=O)C2=C1C=CC(=C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)