CAS 1706462-77-2 is the registry number for 2-Oxa-5-azaspiro(3.5)nonane oxalate, 95+%. Offered by: AmBeed. Available pack sizes: 1g.
2-oxa-5-azaspiro[3.5]nonane;oxalic acid (CAS 1706462-77-2) is a chemical compound with the molecular formula C9H15NO5 and a molecular weight of 217.22 g/mol. IUPAC name: 2-oxa-5-azaspiro[3.5]nonane;oxalic acid. InChIKey: OQWJBTNQYYQHRU-UHFFFAOYSA-N.
| Molecular formula | C9H15NO5 |
|---|---|
| Molecular weight | 217.22 g/mol |
| IUPAC name | 2-oxa-5-azaspiro[3.5]nonane;oxalic acid |
| InChIKey | OQWJBTNQYYQHRU-UHFFFAOYSA-N |
| SMILES | C1CCNC2(C1)COC2.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)