CAS 1706738-98-8 appears in our catalog under these names: 4-(2-(Cyclopropylmethoxy)-5-(methylsulfonyl)phenyl)-2-methylisoquinolin-1(2H)-one, 98%, 98%, Trotabresib, 99%, CC–90010, Trotabresib/ 99.03% (existing batch purity), 4-(2-(Cyclopropylmethoxy)-5-(methylsulfonyl)phenyl)-2-methyl-1(2H)-isoquinolinone. Offered by: Chemat, AmBeed, GLPBio, TargetMol, Biosynth. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 10mM (in 1ml dmso), 1mg, 250mg.
4-[2-(cyclopropylmethoxy)-5-methylsulfonylphenyl]-2-methylisoquinolin-1-one (CAS 1706738-98-8) is a chemical compound with the molecular formula C21H21NO4S and a molecular weight of 383.5 g/mol. IUPAC name: 4-[2-(cyclopropylmethoxy)-5-methylsulfonylphenyl]-2-methylisoquinolin-1-one. InChIKey: UWZAJPITKGWMFJ-UHFFFAOYSA-N.
| Molecular formula | C21H21NO4S |
|---|---|
| Molecular weight | 383.5 g/mol |
| IUPAC name | 4-[2-(cyclopropylmethoxy)-5-methylsulfonylphenyl]-2-methylisoquinolin-1-one |
| InChIKey | UWZAJPITKGWMFJ-UHFFFAOYSA-N |
| SMILES | CN1C=C(C2=CC=CC=C2C1=O)C3=C(C=CC(=C3)S(=O)(=O)C)OCC4CC4 |
Computed by PubChem (NCBI)