CAS 554438-64-1 is the registry number for 3-(N-(3,5-Dimethylphenyl)naphthalene-2-sulfonamido)propanoic acid, 95%. Offered by: AmBeed. Available pack sizes: 5g.
3-(3,5-dimethyl-N-naphthalen-2-ylsulfonylanilino)propanoic acid (CAS 554438-64-1) is a chemical compound with the molecular formula C21H21NO4S and a molecular weight of 383.5 g/mol. IUPAC name: 3-(3,5-dimethyl-N-naphthalen-2-ylsulfonylanilino)propanoic acid. InChIKey: ZWRLBQAGQJIQOY-UHFFFAOYSA-N.
| Molecular formula | C21H21NO4S |
|---|---|
| Molecular weight | 383.5 g/mol |
| IUPAC name | 3-(3,5-dimethyl-N-naphthalen-2-ylsulfonylanilino)propanoic acid |
| InChIKey | ZWRLBQAGQJIQOY-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1)N(CCC(=O)O)S(=O)(=O)C2=CC3=CC=CC=C3C=C2)C |
Computed by PubChem (NCBI)