CAS 1707377-89-6 appears in our catalog under these names: Methyl 4-(1-methyl-1H-1,2,4-triazol-5-yl)benzoate, 97%, Methyl 4-(1-methyl-1H-1,2,4-triazol-5-yl)benzoate. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
Methyl 4-(2-methyl-1,2,4-triazol-3-yl)benzoate (CAS 1707377-89-6) is a chemical compound with the molecular formula C11H11N3O2 and a molecular weight of 217.22 g/mol. IUPAC name: methyl 4-(2-methyl-1,2,4-triazol-3-yl)benzoate. InChIKey: AYPBZLGVJOZILU-UHFFFAOYSA-N.
| Molecular formula | C11H11N3O2 |
|---|---|
| Molecular weight | 217.22 g/mol |
| IUPAC name | methyl 4-(2-methyl-1,2,4-triazol-3-yl)benzoate |
| InChIKey | AYPBZLGVJOZILU-UHFFFAOYSA-N |
| SMILES | CN1C(=NC=N1)C2=CC=C(C=C2)C(=O)OC |
Computed by PubChem (NCBI)