Products 1707737-35-6
CAS 1707737-35-6 appears in our catalog under these names: 2，2–difluoro–1–(4–methylphenyl)cyclopropane–1–carboxylic acid, 2，2-difluoro-1-(4-methylphenyl)cyclopropane-1-carboxylic acid, 2,2-difluoro-1-(4-methylphenyl)cyclopropane-1-carboxylic acid, 95%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 100mg, 1g.
2,2-difluoro-1-(4-methylphenyl)cyclopropane-1-carboxylic acid (CAS 1707737-35-6) is a chemical compound with the molecular formula C11H10F2O2 and a molecular weight of 212.19 g/mol. IUPAC name: 2,2-difluoro-1-(4-methylphenyl)cyclopropane-1-carboxylic acid. InChIKey: WPRKRLACALEMHD-UHFFFAOYSA-N.
| Molecular formula | C11H10F2O2 |
|---|---|
| Molecular weight | 212.19 g/mol |
| IUPAC name | 2,2-difluoro-1-(4-methylphenyl)cyclopropane-1-carboxylic acid |
| InChIKey | WPRKRLACALEMHD-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2(CC2(F)F)C(=O)O |
Computed by PubChem (NCBI)