Products 17079-18-4

CAS 17079-18-4 is the registry number for piperidine-2,3-dicarboxylic acid. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Piperidine-2,3-dicarboxylic acid (CAS 17079-18-4) is a chemical compound with the molecular formula C7H11NO4 and a molecular weight of 173.17 g/mol. IUPAC name: piperidine-2,3-dicarboxylic acid. InChIKey: PTLWNCBCBZZBJI-UHFFFAOYSA-N.

Identity
Molecular formulaC7H11NO4
Molecular weight173.17 g/mol
IUPAC namepiperidine-2,3-dicarboxylic acid
InChIKeyPTLWNCBCBZZBJI-UHFFFAOYSA-N
SMILESC1CC(C(NC1)C(=O)O)C(=O)O

Computed by PubChem (NCBI)