CAS 170861-68-4 appears in our catalog under these names: 2–(5–Methyl–2–phenyloxazol–4–yl)ethyl 4–methylbenzenesulfonate, 2-(5-Methyl-2-phenyloxazol-4-yl)ethyl 4-methylbenzenesulfonate, 95%. Offered by: GLPBio, Combi-blocks. Available pack sizes: 100mg, 1g, 250mg.
2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)ethyl 4-methylbenzenesulfonate (CAS 170861-68-4) is a chemical compound with the molecular formula C19H19NO4S and a molecular weight of 357.4 g/mol. IUPAC name: 2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)ethyl 4-methylbenzenesulfonate. InChIKey: QGNITQXBLBMGSS-UHFFFAOYSA-N.
| Molecular formula | C19H19NO4S |
|---|---|
| Molecular weight | 357.4 g/mol |
| IUPAC name | 2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)ethyl 4-methylbenzenesulfonate |
| InChIKey | QGNITQXBLBMGSS-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OCCC2=C(OC(=N2)C3=CC=CC=C3)C |
Computed by PubChem (NCBI)